Benzyl Butyl Phthalate-d4
Catalog No: FT-0662711
CAS No: 93951-88-3
- Chemical Name: Benzyl Butyl Phthalate-d4
- Molecular Formula: C19H20O4
- Molecular Weight: 316.4
- InChI Key: IRIAEXORFWYRCZ-CXRURWBMSA-N
- InChI: InChI=1S/C19H20O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3/i7D,8D,11D,12D
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 316.38400 |
| Density: | 1.114 g/mL at 25ºC |
| CAS: | 93951-88-3 |
| Bolling_Point: | N/A |
| Product_Name: | 2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Melting_Point: | N/A |
| Flash_Point: | 113ºC |
| MF: | C19H16D4O4 |
| Density: | 1.114 g/mL at 25ºC |
|---|---|
| LogP: | 4.00050 |
| Flash_Point: | 113ºC |
| FW: | 316.38400 |
| PSA: | 52.60000 |
| MF: | C19H16D4O4 |
| Exact_Mass: | 316.16100 |
| Hazard_Codes: | T: Toxic;N: Dangerous for the environment; |
|---|---|
| Risk_Statements(EU): | R61 |
| Safety_Statements: | 53-45-60-61 |
| Symbol: | Danger |
| RIDADR: | UN 3082 9/PG 3 |
| Warning_Statement: | P201-P273-P308 + P313-P501 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)